C22H21N3O6S — CID 42979572
(5-amino-4-cyano-2-ethoxycarbonylthiophen-3-yl)methyl 2-butyl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 42979572) has the molecular formula C22H21N3O6S and a molecular weight of 455.49 g/mol. Its IUPAC name is (5-amino-4-cyano-2-ethoxycarbonylthiophen-3-yl)methyl 2-butyl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (5-amino-4-cyano-2-ethoxycarbonylthiophen-3-yl)methyl 2-butyl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 42979572 |
| Molecular Formula | C22H21N3O6S |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | (5-amino-4-cyano-2-ethoxycarbonylthiophen-3-yl)methyl 2-butyl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CCCCN1C(=O)c2ccc(C(=O)OCc3c(C(=O)OCC)sc(N)c3C#N)cc2C1=O |
| InChI | InChI=1S/C22H21N3O6S/c1-3-5-8-25-19(26)13-7-6-12(9-14(13)20(25)27)21(28)31-11-16-15(10-23)18(24)32-17(16)22(29)30-4-2/h6-7,9H,3-5,8,11,24H2,1-2H3 |
| InChIKey | XGEHTTYBLJGKGJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 139.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|