C19H16ClN3O6S — CID 16604459
dimethyl 5-amino-3-[[3-(4-chlorophenyl)-1H-pyrazole-5-carbonyl]oxymethyl]thiophene-2,4-dicarboxylate (PubChem CID 16604459) has the molecular formula C19H16ClN3O6S and a molecular weight of 449.87 g/mol. Its IUPAC name is dimethyl 5-amino-3-[[3-(4-chlorophenyl)-1H-pyrazole-5-carbonyl]oxymethyl]thiophene-2,4-dicarboxylate.
| Compound Name | dimethyl 5-amino-3-[[3-(4-chlorophenyl)-1H-pyrazole-5-carbonyl]oxymethyl]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 16604459 |
| Molecular Formula | C19H16ClN3O6S |
| Molecular Weight | 449.87 g/mol |
| Exact Mass | 449.04 |
| IUPAC Name | dimethyl 5-amino-3-[[3-(4-chlorophenyl)-1H-pyrazole-5-carbonyl]oxymethyl]thiophene-2,4-dicarboxylate |
| SMILES | COC(=O)c1sc(N)c(C(=O)OC)c1COC(=O)c1cc(-c2ccc(Cl)cc2)n[nH]1 |
| InChI | InChI=1S/C19H16ClN3O6S/c1-27-18(25)14-11(15(19(26)28-2)30-16(14)21)8-29-17(24)13-7-12(22-23-13)9-3-5-10(20)6-4-9/h3-7H,8,21H2,1-2H3,(H,22,23) |
| InChIKey | XYIBYPSZZCNFMC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 133.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.87 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|