C15H13ClFNO4S2 — CID 16572344
dimethyl 5-amino-3-[(3-chloro-4-fluorophenyl)sulfanylmethyl]thiophene-2,4-dicarboxylate (PubChem CID 16572344) has the molecular formula C15H13ClFNO4S2 and a molecular weight of 389.86 g/mol. Its IUPAC name is dimethyl 5-amino-3-[(3-chloro-4-fluorophenyl)sulfanylmethyl]thiophene-2,4-dicarboxylate.
| Compound Name | dimethyl 5-amino-3-[(3-chloro-4-fluorophenyl)sulfanylmethyl]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 16572344 |
| Molecular Formula | C15H13ClFNO4S2 |
| Molecular Weight | 389.86 g/mol |
| Exact Mass | 389.00 |
| IUPAC Name | dimethyl 5-amino-3-[(3-chloro-4-fluorophenyl)sulfanylmethyl]thiophene-2,4-dicarboxylate |
| SMILES | COC(=O)c1sc(N)c(C(=O)OC)c1CSc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C15H13ClFNO4S2/c1-21-14(19)11-8(12(15(20)22-2)24-13(11)18)6-23-7-3-4-10(17)9(16)5-7/h3-5H,6,18H2,1-2H3 |
| InChIKey | SKDFGZAAFAYMGT-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.86 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|