C15H14FNO4S2 — CID 7964665
dimethyl 5-amino-3-[(2-fluorophenyl)sulfanylmethyl]thiophene-2,4-dicarboxylate (PubChem CID 7964665) has the molecular formula C15H14FNO4S2 and a molecular weight of 355.41 g/mol. Its IUPAC name is dimethyl 5-amino-3-[(2-fluorophenyl)sulfanylmethyl]thiophene-2,4-dicarboxylate.
| Compound Name | dimethyl 5-amino-3-[(2-fluorophenyl)sulfanylmethyl]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 7964665 |
| Molecular Formula | C15H14FNO4S2 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | dimethyl 5-amino-3-[(2-fluorophenyl)sulfanylmethyl]thiophene-2,4-dicarboxylate |
| SMILES | COC(=O)c1sc(N)c(C(=O)OC)c1CSc1ccccc1F |
| InChI | InChI=1S/C15H14FNO4S2/c1-20-14(18)11-8(12(15(19)21-2)23-13(11)17)7-22-10-6-4-3-5-9(10)16/h3-6H,7,17H2,1-2H3 |
| InChIKey | MSSDCZICEZLFHJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|