C18H19NO6S2 — CID 7976559
dimethyl 5-amino-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanylmethyl)thiophene-2,4-dicarboxylate (PubChem CID 7976559) has the molecular formula C18H19NO6S2 and a molecular weight of 409.49 g/mol. Its IUPAC name is dimethyl 5-amino-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanylmethyl)thiophene-2,4-dicarboxylate.
| Compound Name | dimethyl 5-amino-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanylmethyl)thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 7976559 |
| Molecular Formula | C18H19NO6S2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | dimethyl 5-amino-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanylmethyl)thiophene-2,4-dicarboxylate |
| SMILES | COC(=O)c1sc(N)c(C(=O)OC)c1CSc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C18H19NO6S2/c1-22-17(20)14-11(15(18(21)23-2)27-16(14)19)9-26-10-4-5-12-13(8-10)25-7-3-6-24-12/h4-5,8H,3,6-7,9,19H2,1-2H3 |
| InChIKey | JBNRARLRAGQWBA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|