C16H14N2O4S3 — CID 7465237
dimethyl 5-amino-3-(1,3-benzothiazol-2-ylsulfanylmethyl)thiophene-2,4-dicarboxylate (PubChem CID 7465237) has the molecular formula C16H14N2O4S3 and a molecular weight of 394.50 g/mol. Its IUPAC name is dimethyl 5-amino-3-(1,3-benzothiazol-2-ylsulfanylmethyl)thiophene-2,4-dicarboxylate.
| Compound Name | dimethyl 5-amino-3-(1,3-benzothiazol-2-ylsulfanylmethyl)thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 7465237 |
| Molecular Formula | C16H14N2O4S3 |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | dimethyl 5-amino-3-(1,3-benzothiazol-2-ylsulfanylmethyl)thiophene-2,4-dicarboxylate |
| SMILES | COC(=O)c1sc(N)c(C(=O)OC)c1CSc1nc2ccccc2s1 |
| InChI | InChI=1S/C16H14N2O4S3/c1-21-14(19)11-8(12(15(20)22-2)25-13(11)17)7-23-16-18-9-5-3-4-6-10(9)24-16/h3-6H,7,17H2,1-2H3 |
| InChIKey | WLTOGHBPMDZNQS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|