C12H14N2O3S2 — CID 79676474
2-(1,3-benzothiazol-2-ylsulfanyl)-N-(2-methoxyethoxy)acetamide (PubChem CID 79676474) has the molecular formula C12H14N2O3S2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-N-(2-methoxyethoxy)acetamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-(2-methoxyethoxy)acetamide |
|---|---|
| PubChem CID | 79676474 |
| Molecular Formula | C12H14N2O3S2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-(2-methoxyethoxy)acetamide |
| SMILES | COCCONC(=O)CSc1nc2ccccc2s1 |
| InChI | InChI=1S/C12H14N2O3S2/c1-16-6-7-17-14-11(15)8-18-12-13-9-4-2-3-5-10(9)19-12/h2-5H,6-8H2,1H3,(H,14,15) |
| InChIKey | BBQXELZHHINUOT-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|