C14H17N3O2S2 — CID 2620979
2-(1,3-benzothiazol-2-ylsulfanyl)-N-(tert-butylcarbamoyl)acetamide (PubChem CID 2620979) has the molecular formula C14H17N3O2S2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-N-(tert-butylcarbamoyl)acetamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-(tert-butylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 2620979 |
| Molecular Formula | C14H17N3O2S2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-(tert-butylcarbamoyl)acetamide |
| SMILES | CC(C)(C)NC(=O)NC(=O)CSc1nc2ccccc2s1 |
| InChI | InChI=1S/C14H17N3O2S2/c1-14(2,3)17-12(19)16-11(18)8-20-13-15-9-6-4-5-7-10(9)21-13/h4-7H,8H2,1-3H3,(H2,16,17,18,19) |
| InChIKey | KVFIYUZPYYYOFG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |