C15H11NO2S3 — CID 154095948
methyl 2-(1,3-benzothiazol-2-yldisulfanyl)benzoate (PubChem CID 154095948) has the molecular formula C15H11NO2S3 and a molecular weight of 333.46 g/mol. Its IUPAC name is methyl 2-(1,3-benzothiazol-2-yldisulfanyl)benzoate.
| Compound Name | methyl 2-(1,3-benzothiazol-2-yldisulfanyl)benzoate |
|---|---|
| PubChem CID | 154095948 |
| Molecular Formula | C15H11NO2S3 |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | methyl 2-(1,3-benzothiazol-2-yldisulfanyl)benzoate |
| SMILES | COC(=O)c1ccccc1SSc1nc2ccccc2s1 |
| InChI | InChI=1S/C15H11NO2S3/c1-18-14(17)10-6-2-4-8-12(10)20-21-15-16-11-7-3-5-9-13(11)19-15/h2-9H,1H3 |
| InChIKey | BKHZGUGGJIIGFJ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|