C18H14N2O2S4 — CID 175321110
2-(1,3-benzothiazol-2-yldisulfanyl)-1,3-benzothiazole;2-methylprop-2-enoic acid (PubChem CID 175321110) has the molecular formula C18H14N2O2S4 and a molecular weight of 418.59 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yldisulfanyl)-1,3-benzothiazole;2-methylprop-2-enoic acid.
| Compound Name | 2-(1,3-benzothiazol-2-yldisulfanyl)-1,3-benzothiazole;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 175321110 |
| Molecular Formula | C18H14N2O2S4 |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 417.99 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yldisulfanyl)-1,3-benzothiazole;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.c1ccc2sc(SSc3nc4ccccc4s3)nc2c1 |
| InChI | InChI=1S/C14H8N2S4.C4H6O2/c1-3-7-11-9(5-1)15-13(17-11)19-20-14-16-10-6-2-4-8-12(10)18-14;1-3(2)4(5)6/h1-8H;1H2,2H3,(H,5,6) |
| InChIKey | NHYNJHUMMQDTQT-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|