C32H44N2O2S4 — CID 174976194
2-(1,3-benzothiazol-2-yldisulfanyl)-1,3-benzothiazole;octadecanoic acid (PubChem CID 174976194) has the molecular formula C32H44N2O2S4 and a molecular weight of 616.98 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yldisulfanyl)-1,3-benzothiazole;octadecanoic acid.
| Compound Name | 2-(1,3-benzothiazol-2-yldisulfanyl)-1,3-benzothiazole;octadecanoic acid |
|---|---|
| PubChem CID | 174976194 |
| Molecular Formula | C32H44N2O2S4 |
| Molecular Weight | 616.98 g/mol |
| Exact Mass | 616.23 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yldisulfanyl)-1,3-benzothiazole;octadecanoic acid |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)O.c1ccc2sc(SSc3nc4ccccc4s3)nc2c1 |
| InChI | InChI=1S/C18H36O2.C14H8N2S4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-3-7-11-9(5-1)15-13(17-11)19-20-14-16-10-6-2-4-8-12(10)18-14/h2-17H2,1H3,(H,19,20);1-8H |
| InChIKey | HFWDJTGZANIQQC-UHFFFAOYSA-N |
| XLogP | 12.04 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.98 |
| LogP ≤ 5 | 12.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|