C22H26N2OS3 — CID 159562936
2-ethylsulfanyl-1,3-benzothiazole;2-hexoxy-1,3-benzothiazole (PubChem CID 159562936) has the molecular formula C22H26N2OS3 and a molecular weight of 430.66 g/mol. Its IUPAC name is 2-ethylsulfanyl-1,3-benzothiazole;2-hexoxy-1,3-benzothiazole.
| Compound Name | 2-ethylsulfanyl-1,3-benzothiazole;2-hexoxy-1,3-benzothiazole |
|---|---|
| PubChem CID | 159562936 |
| Molecular Formula | C22H26N2OS3 |
| Molecular Weight | 430.66 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 2-ethylsulfanyl-1,3-benzothiazole;2-hexoxy-1,3-benzothiazole |
| SMILES | CCCCCCOc1nc2ccccc2s1.CCSc1nc2ccccc2s1 |
| InChI | InChI=1S/C13H17NOS.C9H9NS2/c1-2-3-4-7-10-15-13-14-11-8-5-6-9-12(11)16-13;1-2-11-9-10-7-5-3-4-6-8(7)12-9/h5-6,8-9H,2-4,7,10H2,1H3;3-6H,2H2,1H3 |
| InChIKey | MGVQSCHLTNJIJO-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.66 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|