C34H61NO3S6Si — CID 54358202
1-(1,3-benzothiazol-2-ylpentasulfanyl)propan-2-yl-trioctoxysilane (PubChem CID 54358202) has the molecular formula C34H61NO3S6Si and a molecular weight of 752.35 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-ylpentasulfanyl)propan-2-yl-trioctoxysilane.
| Compound Name | 1-(1,3-benzothiazol-2-ylpentasulfanyl)propan-2-yl-trioctoxysilane |
|---|---|
| PubChem CID | 54358202 |
| Molecular Formula | C34H61NO3S6Si |
| Molecular Weight | 752.35 g/mol |
| Exact Mass | 751.27 |
| IUPAC Name | 1-(1,3-benzothiazol-2-ylpentasulfanyl)propan-2-yl-trioctoxysilane |
| SMILES | CCCCCCCCO[Si](OCCCCCCCC)(OCCCCCCCC)C(C)CSSSSSc1nc2ccccc2s1 |
| InChI | InChI=1S/C34H61NO3S6Si/c1-5-8-11-14-17-22-27-36-45(37-28-23-18-15-12-9-6-2,38-29-24-19-16-13-10-7-3)31(4)30-39-42-44-43-41-34-35-32-25-20-21-26-33(32)40-34/h20-21,25-26,31H,5-19,22-24,27-30H2,1-4H3 |
| InChIKey | UKPRUHRPNNALML-UHFFFAOYSA-N |
| XLogP | 14.44 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.35 |
| LogP ≤ 5 | 14.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|