C14H21NO3S5Si — CID 54109988
4-(1,3-benzothiazol-2-yltetrasulfanyl)butyl-trimethoxysilane (PubChem CID 54109988) has the molecular formula C14H21NO3S5Si and a molecular weight of 439.75 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yltetrasulfanyl)butyl-trimethoxysilane.
| Compound Name | 4-(1,3-benzothiazol-2-yltetrasulfanyl)butyl-trimethoxysilane |
|---|---|
| PubChem CID | 54109988 |
| Molecular Formula | C14H21NO3S5Si |
| Molecular Weight | 439.75 g/mol |
| Exact Mass | 438.99 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yltetrasulfanyl)butyl-trimethoxysilane |
| SMILES | CO[Si](CCCCSSSSc1nc2ccccc2s1)(OC)OC |
| InChI | InChI=1S/C14H21NO3S5Si/c1-16-24(17-2,18-3)11-7-6-10-19-22-23-21-14-15-12-8-4-5-9-13(12)20-14/h4-5,8-9H,6-7,10-11H2,1-3H3 |
| InChIKey | NGKKKSPSQICHLV-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.75 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|