C22H29NO3S4Si — CID 54262910
3-[2-(1,3-benzothiazol-2-yltrisulfanyl)phenyl]propyl-triethoxysilane (PubChem CID 54262910) has the molecular formula C22H29NO3S4Si and a molecular weight of 511.83 g/mol. Its IUPAC name is 3-[2-(1,3-benzothiazol-2-yltrisulfanyl)phenyl]propyl-triethoxysilane.
| Compound Name | 3-[2-(1,3-benzothiazol-2-yltrisulfanyl)phenyl]propyl-triethoxysilane |
|---|---|
| PubChem CID | 54262910 |
| Molecular Formula | C22H29NO3S4Si |
| Molecular Weight | 511.83 g/mol |
| Exact Mass | 511.08 |
| IUPAC Name | 3-[2-(1,3-benzothiazol-2-yltrisulfanyl)phenyl]propyl-triethoxysilane |
| SMILES | CCO[Si](CCCc1ccccc1SSSc1nc2ccccc2s1)(OCC)OCC |
| InChI | InChI=1S/C22H29NO3S4Si/c1-4-24-31(25-5-2,26-6-3)17-11-13-18-12-7-9-15-20(18)28-30-29-22-23-19-14-8-10-16-21(19)27-22/h7-10,12,14-16H,4-6,11,13,17H2,1-3H3 |
| InChIKey | RETLEIYYJFILGX-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.83 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|