C32H48N2O6S4Si2 — CID 57142754
[3-(1,3-benzothiazol-2-yl)-3-[[1-(1,3-benzothiazol-2-yl)-3-triethoxysilylpropyl]disulfanyl]propyl]-triethoxysilane (PubChem CID 57142754) has the molecular formula C32H48N2O6S4Si2 and a molecular weight of 741.18 g/mol. Its IUPAC name is [3-(1,3-benzothiazol-2-yl)-3-[[1-(1,3-benzothiazol-2-yl)-3-triethoxysilylpropyl]disulfanyl]propyl]-triethoxysilane.
| Compound Name | [3-(1,3-benzothiazol-2-yl)-3-[[1-(1,3-benzothiazol-2-yl)-3-triethoxysilylpropyl]disulfanyl]propyl]-triethoxysilane |
|---|---|
| PubChem CID | 57142754 |
| Molecular Formula | C32H48N2O6S4Si2 |
| Molecular Weight | 741.18 g/mol |
| Exact Mass | 740.19 |
| IUPAC Name | [3-(1,3-benzothiazol-2-yl)-3-[[1-(1,3-benzothiazol-2-yl)-3-triethoxysilylpropyl]disulfanyl]propyl]-triethoxysilane |
| SMILES | CCO[Si](CCC(SSC(CC[Si](OCC)(OCC)OCC)c1nc2ccccc2s1)c1nc2ccccc2s1)(OCC)OCC |
| InChI | InChI=1S/C32H48N2O6S4Si2/c1-7-35-45(36-8-2,37-9-3)23-21-29(31-33-25-17-13-15-19-27(25)41-31)43-44-30(32-34-26-18-14-16-20-28(26)42-32)22-24-46(38-10-4,39-11-5)40-12-6/h13-20,29-30H,7-12,21-24H2,1-6H3 |
| InChIKey | HGOFWWQABPICLX-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 81.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.18 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|