C15H20NO2SSi — CID 173322757
CID 173322757 (PubChem CID 173322757) has the molecular formula C15H20NO2SSi and a molecular weight of 306.48 g/mol.
| Compound Name | CID 173322757 |
|---|---|
| PubChem CID | 173322757 |
| Molecular Formula | C15H20NO2SSi |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | — |
| SMILES | CCOC(OCC)C([Si])C(C)c1nc2ccccc2s1 |
| InChI | InChI=1S/C15H20NO2SSi/c1-4-17-15(18-5-2)13(20)10(3)14-16-11-8-6-7-9-12(11)19-14/h6-10,13,15H,4-5H2,1-3H3 |
| InChIKey | RFPARJRPNLRZDY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|