C10H11NO3S2 — CID 18932378
1-(1,3-benzothiazol-2-yl)ethyl methanesulfonate (PubChem CID 18932378) has the molecular formula C10H11NO3S2 and a molecular weight of 257.34 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)ethyl methanesulfonate.
| Compound Name | 1-(1,3-benzothiazol-2-yl)ethyl methanesulfonate |
|---|---|
| PubChem CID | 18932378 |
| Molecular Formula | C10H11NO3S2 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.02 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)ethyl methanesulfonate |
| SMILES | CC(OS(C)(=O)=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C10H11NO3S2/c1-7(14-16(2,12)13)10-11-8-5-3-4-6-9(8)15-10/h3-7H,1-2H3 |
| InChIKey | YTKAYNVMRQZAIH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|