C12H13NOS — CID 10856987
(1S,2R)-1-(1,3-benzothiazol-2-yl)-2-methylbut-3-en-1-ol (PubChem CID 10856987) has the molecular formula C12H13NOS and a molecular weight of 219.31 g/mol. Its IUPAC name is (1S,2R)-1-(1,3-benzothiazol-2-yl)-2-methylbut-3-en-1-ol.
| Compound Name | (1S,2R)-1-(1,3-benzothiazol-2-yl)-2-methylbut-3-en-1-ol |
|---|---|
| PubChem CID | 10856987 |
| Molecular Formula | C12H13NOS |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | (1S,2R)-1-(1,3-benzothiazol-2-yl)-2-methylbut-3-en-1-ol |
| SMILES | C=C[C@@H](C)[C@H](O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C12H13NOS/c1-3-8(2)11(14)12-13-9-6-4-5-7-10(9)15-12/h3-8,11,14H,1H2,2H3/t8-,11+/m1/s1 |
| InChIKey | CROWMXUSAIMMRU-KCJUWKMLSA-N |
| XLogP | 3.15 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|