C9H8INS — CID 173330780
2-ethenyl-1,3-benzothiazole;hydroiodide (PubChem CID 173330780) has the molecular formula C9H8INS and a molecular weight of 289.14 g/mol. Its IUPAC name is 2-ethenyl-1,3-benzothiazole;hydroiodide.
| Compound Name | 2-ethenyl-1,3-benzothiazole;hydroiodide |
|---|---|
| PubChem CID | 173330780 |
| Molecular Formula | C9H8INS |
| Molecular Weight | 289.14 g/mol |
| Exact Mass | 288.94 |
| IUPAC Name | 2-ethenyl-1,3-benzothiazole;hydroiodide |
| SMILES | C=Cc1nc2ccccc2s1.I |
| InChI | InChI=1S/C9H7NS.HI/c1-2-9-10-7-5-3-4-6-8(7)11-9;/h2-6H,1H2;1H |
| InChIKey | JNRPLTWDOYKGQA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.14 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|