C9H5Br2NS — CID 139773786
2-(2,2-dibromoethenyl)-1,3-benzothiazole (PubChem CID 139773786) has the molecular formula C9H5Br2NS and a molecular weight of 319.02 g/mol. Its IUPAC name is 2-(2,2-dibromoethenyl)-1,3-benzothiazole.
| Compound Name | 2-(2,2-dibromoethenyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 139773786 |
| Molecular Formula | C9H5Br2NS |
| Molecular Weight | 319.02 g/mol |
| Exact Mass | 316.85 |
| IUPAC Name | 2-(2,2-dibromoethenyl)-1,3-benzothiazole |
| SMILES | BrC(Br)=Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C9H5Br2NS/c10-8(11)5-9-12-6-3-1-2-4-7(6)13-9/h1-5H |
| InChIKey | PWMWLRAVHGZPFZ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.02 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |