C16H11NO2S — CID 13082335
(E)-3-(1,3-benzothiazol-2-yl)-2-phenylprop-2-enoic acid (PubChem CID 13082335) has the molecular formula C16H11NO2S and a molecular weight of 281.34 g/mol. Its IUPAC name is (E)-3-(1,3-benzothiazol-2-yl)-2-phenylprop-2-enoic acid.
| Compound Name | (E)-3-(1,3-benzothiazol-2-yl)-2-phenylprop-2-enoic acid |
|---|---|
| PubChem CID | 13082335 |
| Molecular Formula | C16H11NO2S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | (E)-3-(1,3-benzothiazol-2-yl)-2-phenylprop-2-enoic acid |
| SMILES | O=C(O)/C(=C/c1nc2ccccc2s1)c1ccccc1 |
| InChI | InChI=1S/C16H11NO2S/c18-16(19)12(11-6-2-1-3-7-11)10-15-17-13-8-4-5-9-14(13)20-15/h1-10H,(H,18,19)/b12-10+ |
| InChIKey | RIWHJCZSCCBYKX-ZRDIBKRKSA-N |
| XLogP | 3.92 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|