C23H15NO3S — CID 3622106
4-[2-(1,3-benzothiazol-2-yl)-3-oxo-3-phenylprop-1-enyl]benzoic acid (PubChem CID 3622106) has the molecular formula C23H15NO3S and a molecular weight of 385.44 g/mol. Its IUPAC name is 4-[2-(1,3-benzothiazol-2-yl)-3-oxo-3-phenylprop-1-enyl]benzoic acid.
| Compound Name | 4-[2-(1,3-benzothiazol-2-yl)-3-oxo-3-phenylprop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 3622106 |
| Molecular Formula | C23H15NO3S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 4-[2-(1,3-benzothiazol-2-yl)-3-oxo-3-phenylprop-1-enyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C=C(C(=O)c2ccccc2)c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C23H15NO3S/c25-21(16-6-2-1-3-7-16)18(14-15-10-12-17(13-11-15)23(26)27)22-24-19-8-4-5-9-20(19)28-22/h1-14H,(H,26,27) |
| InChIKey | TYPSIOJRJPUDHA-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|