C23H17NO2S — CID 2873903
2-(1,3-benzothiazol-2-yl)-3-(4-methoxyphenyl)-1-phenylprop-2-en-1-one (PubChem CID 2873903) has the molecular formula C23H17NO2S and a molecular weight of 371.46 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-3-(4-methoxyphenyl)-1-phenylprop-2-en-1-one.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-3-(4-methoxyphenyl)-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 2873903 |
| Molecular Formula | C23H17NO2S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-3-(4-methoxyphenyl)-1-phenylprop-2-en-1-one |
| SMILES | COc1ccc(C=C(C(=O)c2ccccc2)c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C23H17NO2S/c1-26-18-13-11-16(12-14-18)15-19(22(25)17-7-3-2-4-8-17)23-24-20-9-5-6-10-21(20)27-23/h2-15H,1H3 |
| InChIKey | VQAGPJTUHFSNBI-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|