C28H22N2OS — CID 3510325
2-(1,3-benzothiazol-2-yl)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-1-phenylprop-2-en-1-one (PubChem CID 3510325) has the molecular formula C28H22N2OS and a molecular weight of 434.56 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-1-phenylprop-2-en-1-one.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 3510325 |
| Molecular Formula | C28H22N2OS |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-1-phenylprop-2-en-1-one |
| SMILES | Cc1cc(C=C(C(=O)c2ccccc2)c2nc3ccccc3s2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C28H22N2OS/c1-19-17-22(20(2)30(19)23-13-7-4-8-14-23)18-24(27(31)21-11-5-3-6-12-21)28-29-25-15-9-10-16-26(25)32-28/h3-18H,1-2H3 |
| InChIKey | QXLIVKPDAHNTSA-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|