C30H26N2OS — CID 4273542
2-(1,3-benzothiazol-2-yl)-3-[1-(2,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-1-phenylprop-2-en-1-one (PubChem CID 4273542) has the molecular formula C30H26N2OS and a molecular weight of 462.62 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-3-[1-(2,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-1-phenylprop-2-en-1-one.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-3-[1-(2,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 4273542 |
| Molecular Formula | C30H26N2OS |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-3-[1-(2,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-1-phenylprop-2-en-1-one |
| SMILES | Cc1ccc(-n2c(C)cc(C=C(C(=O)c3ccccc3)c3nc4ccccc4s3)c2C)c(C)c1 |
| InChI | InChI=1S/C30H26N2OS/c1-19-14-15-27(20(2)16-19)32-21(3)17-24(22(32)4)18-25(29(33)23-10-6-5-7-11-23)30-31-26-12-8-9-13-28(26)34-30/h5-18H,1-4H3 |
| InChIKey | GDUXZYUWSDNHRJ-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|