C22H15NO2S — CID 135494332
(E)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-1,3-diphenylprop-2-en-1-one (PubChem CID 135494332) has the molecular formula C22H15NO2S and a molecular weight of 357.43 g/mol. Its IUPAC name is (E)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-1,3-diphenylprop-2-en-1-one.
| Compound Name | (E)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-1,3-diphenylprop-2-en-1-one |
|---|---|
| PubChem CID | 135494332 |
| Molecular Formula | C22H15NO2S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | (E)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-1,3-diphenylprop-2-en-1-one |
| SMILES | O=C(/C(=C(\O)c1ccccc1)c1nc2ccccc2s1)c1ccccc1 |
| InChI | InChI=1S/C22H15NO2S/c24-20(15-9-3-1-4-10-15)19(21(25)16-11-5-2-6-12-16)22-23-17-13-7-8-14-18(17)26-22/h1-14,24H/b20-19+ |
| InChIKey | SUSSSZOENHMAJI-FMQUCBEESA-N |
| XLogP | 5.61 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|