C8H5NO2S2 — CID 87987373
sulfanyl 1,3-benzothiazole-2-carboxylate (PubChem CID 87987373) has the molecular formula C8H5NO2S2 and a molecular weight of 211.27 g/mol. Its IUPAC name is sulfanyl 1,3-benzothiazole-2-carboxylate.
| Compound Name | sulfanyl 1,3-benzothiazole-2-carboxylate |
|---|---|
| PubChem CID | 87987373 |
| Molecular Formula | C8H5NO2S2 |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 210.98 |
| IUPAC Name | sulfanyl 1,3-benzothiazole-2-carboxylate |
| SMILES | O=C(OS)c1nc2ccccc2s1 |
| InChI | InChI=1S/C8H5NO2S2/c10-8(11-12)7-9-5-3-1-2-4-6(5)13-7/h1-4,12H |
| InChIKey | OBQKCMVPRZRKOY-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 39.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|