C10H7NO2S — CID 51508743
1-(1,3-benzothiazol-2-yl)-3-hydroxyprop-2-en-1-one (PubChem CID 51508743) has the molecular formula C10H7NO2S and a molecular weight of 205.24 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-3-hydroxyprop-2-en-1-one.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-3-hydroxyprop-2-en-1-one |
|---|---|
| PubChem CID | 51508743 |
| Molecular Formula | C10H7NO2S |
| Molecular Weight | 205.24 g/mol |
| Exact Mass | 205.02 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-3-hydroxyprop-2-en-1-one |
| SMILES | O=C(C=CO)c1nc2ccccc2s1 |
| InChI | InChI=1S/C10H7NO2S/c12-6-5-8(13)10-11-7-3-1-2-4-9(7)14-10/h1-6,12H |
| InChIKey | CSANFXYKSRVHBW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.24 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|