C9H9ClN4OS — CID 22097901
N-(diaminomethylidene)-1,3-benzothiazole-2-carboxamide;hydrochloride (PubChem CID 22097901) has the molecular formula C9H9ClN4OS and a molecular weight of 256.72 g/mol. Its IUPAC name is N-(diaminomethylidene)-1,3-benzothiazole-2-carboxamide;hydrochloride.
| Compound Name | N-(diaminomethylidene)-1,3-benzothiazole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 22097901 |
| Molecular Formula | C9H9ClN4OS |
| Molecular Weight | 256.72 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | N-(diaminomethylidene)-1,3-benzothiazole-2-carboxamide;hydrochloride |
| SMILES | Cl.NC(N)=NC(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C9H8N4OS.ClH/c10-9(11)13-7(14)8-12-5-3-1-2-4-6(5)15-8;/h1-4H,(H4,10,11,13,14);1H |
| InChIKey | CNIVZGWEROXTSM-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.72 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|