About 1-(1,3-benzothiazol-2-yl)-N-(diaminomethylidene)-5-ethylpyrazole-4-carboxamide;hydrochloride
1-(1,3-benzothiazol-2-yl)-N-(diaminomethylidene)-5-ethylpyrazole-4-carboxamide;hydrochloride (PubChem CID 22267916) has the molecular formula C14H15ClN6OS
and a molecular weight of 350.84 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-N-(diaminomethylidene)-5-ethylpyrazole-4-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | 1-(1,3-benzothiazol-2-yl)-N-(diaminomethylidene)-5-ethylpyrazole-4-carboxamide;hydrochloride |
| PubChem CID | 22267916 |
| Molecular Formula | C14H15ClN6OS |
| Molecular Weight | 350.84 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-N-(diaminomethylidene)-5-ethylpyrazole-4-carboxamide;hydrochloride |
| SMILES | CCc1c(C(=O)N=C(N)N)cnn1-c1nc2ccccc2s1.Cl |
| InChI | InChI=1S/C14H14N6OS.ClH/c1-2-10-8(12(21)19-13(15)16)7-17-20(10)14-18-9-5-3-4-6-11(9)22-14;/h3-7H,2H2,1H3,(H4,15,16,19,21);1H |
| InChIKey | SNMNXADMFMACGZ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.84 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,3-benzothiazol-2-yl)-N-(diaminomethylidene)-5-ethylpyrazole-4-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-benzothiazol-2-yl)-N-(diaminomethylidene)-5-ethylpyrazole-4-carboxamide;hydrochloride?
The IUPAC name of 1-(1,3-benzothiazol-2-yl)-N-(diaminomethylidene)-5-ethylpyrazole-4-carboxamide;hydrochloride (CID 22267916) is 1-(1,3-benzothiazol-2-yl)-N-(diaminomethylidene)-5-ethylpyrazole-4-carboxamide;hydrochloride.
What is the SMILES notation for 1-(1,3-benzothiazol-2-yl)-N-(diaminomethylidene)-5-ethylpyrazole-4-carboxamide;hydrochloride?
The canonical SMILES for 1-(1,3-benzothiazol-2-yl)-N-(diaminomethylidene)-5-ethylpyrazole-4-carboxamide;hydrochloride is CCc1c(C(=O)N=C(N)N)cnn1-c1nc2ccccc2s1.Cl.
What is the InChIKey of 1-(1,3-benzothiazol-2-yl)-N-(diaminomethylidene)-5-ethylpyrazole-4-carboxamide;hydrochloride?
The InChIKey is SNMNXADMFMACGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N6OS.ClH/c1-2-10-8(12(21)19-13(15)16)7-17-20(10)14-18-9-5-3-4-6-11(9)22-14;/h3-7H,2H2,1H3,(H4,15,16,19,21);1H.
What are the key properties of 1-(1,3-benzothiazol-2-yl)-N-(diaminomethylidene)-5-ethylpyrazole-4-carboxamide;hydrochloride?
1-(1,3-benzothiazol-2-yl)-N-(diaminomethylidene)-5-ethylpyrazole-4-carboxamide;hydrochloride has a molecular weight of 350.84 g/mol, XLogP of 1.88, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-benzothiazol-2-yl)-N-(diaminomethylidene)-5-ethylpyrazole-4-carboxamide;hydrochloride is sourced from PubChem (CID 22267916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).