C14H15ClN6OS — CID 22267916
1-(1,3-benzothiazol-2-yl)-N-(diaminomethylidene)-5-ethylpyrazole-4-carboxamide;hydrochloride (PubChem CID 22267916) has the molecular formula C14H15ClN6OS and a molecular weight of 350.84 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-N-(diaminomethylidene)-5-ethylpyrazole-4-carboxamide;hydrochloride.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-N-(diaminomethylidene)-5-ethylpyrazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 22267916 |
| Molecular Formula | C14H15ClN6OS |
| Molecular Weight | 350.84 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-N-(diaminomethylidene)-5-ethylpyrazole-4-carboxamide;hydrochloride |
| SMILES | CCc1c(C(=O)N=C(N)N)cnn1-c1nc2ccccc2s1.Cl |
| InChI | InChI=1S/C14H14N6OS.ClH/c1-2-10-8(12(21)19-13(15)16)7-17-20(10)14-18-9-5-3-4-6-11(9)22-14;/h3-7H,2H2,1H3,(H4,15,16,19,21);1H |
| InChIKey | SNMNXADMFMACGZ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.84 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|