C9H8N6S — CID 58976966
1-(1,3-benzothiazol-2-yl)-1,2,4-triazole-3,5-diamine (PubChem CID 58976966) has the molecular formula C9H8N6S and a molecular weight of 232.27 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-1,2,4-triazole-3,5-diamine.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 58976966 |
| Molecular Formula | C9H8N6S |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-1,2,4-triazole-3,5-diamine |
| SMILES | Nc1nc(N)n(-c2nc3ccccc3s2)n1 |
| InChI | InChI=1S/C9H8N6S/c10-7-13-8(11)15(14-7)9-12-5-3-1-2-4-6(5)16-9/h1-4H,(H4,10,11,13,14) |
| InChIKey | UNELHUAXHMPWQZ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |