C11H11N5OS — CID 79872179
2-(1,3-benzothiazol-2-yl)-5-ethoxy-1,2,4-triazol-3-amine (PubChem CID 79872179) has the molecular formula C11H11N5OS and a molecular weight of 261.31 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-5-ethoxy-1,2,4-triazol-3-amine.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-5-ethoxy-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 79872179 |
| Molecular Formula | C11H11N5OS |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-5-ethoxy-1,2,4-triazol-3-amine |
| SMILES | CCOc1nc(N)n(-c2nc3ccccc3s2)n1 |
| InChI | InChI=1S/C11H11N5OS/c1-2-17-10-14-9(12)16(15-10)11-13-7-5-3-4-6-8(7)18-11/h3-6H,2H2,1H3,(H2,12,14,15) |
| InChIKey | YAWLAWXWOKUMJR-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |