C10H11ClN4O — CID 79873164
2-(2-chlorophenyl)-5-ethoxy-1,2,4-triazol-3-amine (PubChem CID 79873164) has the molecular formula C10H11ClN4O and a molecular weight of 238.68 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-5-ethoxy-1,2,4-triazol-3-amine.
| Compound Name | 2-(2-chlorophenyl)-5-ethoxy-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 79873164 |
| Molecular Formula | C10H11ClN4O |
| Molecular Weight | 238.68 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 2-(2-chlorophenyl)-5-ethoxy-1,2,4-triazol-3-amine |
| SMILES | CCOc1nc(N)n(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C10H11ClN4O/c1-2-16-10-13-9(12)15(14-10)8-6-4-3-5-7(8)11/h3-6H,2H2,1H3,(H2,12,13,14) |
| InChIKey | BWJAGMBMWNCJSL-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.68 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |