C18H10N6OS2 — CID 11058239
14-amino-13-(1,3-benzothiazol-2-yl)-8-thia-1,10,12,13-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,9,11,14-hexaen-16-one (PubChem CID 11058239) has the molecular formula C18H10N6OS2 and a molecular weight of 390.45 g/mol. Its IUPAC name is 14-amino-13-(1,3-benzothiazol-2-yl)-8-thia-1,10,12,13-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,9,11,14-hexaen-16-one.
| Compound Name | 14-amino-13-(1,3-benzothiazol-2-yl)-8-thia-1,10,12,13-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,9,11,14-hexaen-16-one |
|---|---|
| PubChem CID | 11058239 |
| Molecular Formula | C18H10N6OS2 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | 14-amino-13-(1,3-benzothiazol-2-yl)-8-thia-1,10,12,13-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,9,11,14-hexaen-16-one |
| SMILES | Nc1c2c(=O)n3c(nc2nn1-c1nc2ccccc2s1)sc1ccccc13 |
| InChI | InChI=1S/C18H10N6OS2/c19-14-13-15(22-24(14)18-20-9-5-1-3-7-11(9)26-18)21-17-23(16(13)25)10-6-2-4-8-12(10)27-17/h1-8H,19H2 |
| InChIKey | WYFYGLBMYUGBPP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 91.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |