C16H12N2S — CID 142553581
2-methyl-1-phenylimidazo[2,1-b][1,3]benzothiazole (PubChem CID 142553581) has the molecular formula C16H12N2S and a molecular weight of 264.35 g/mol. Its IUPAC name is 2-methyl-1-phenylimidazo[2,1-b][1,3]benzothiazole.
| Compound Name | 2-methyl-1-phenylimidazo[2,1-b][1,3]benzothiazole |
|---|---|
| PubChem CID | 142553581 |
| Molecular Formula | C16H12N2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 2-methyl-1-phenylimidazo[2,1-b][1,3]benzothiazole |
| SMILES | Cc1nc2sc3ccccc3n2c1-c1ccccc1 |
| InChI | InChI=1S/C16H12N2S/c1-11-15(12-7-3-2-4-8-12)18-13-9-5-6-10-14(13)19-16(18)17-11/h2-10H,1H3 |
| InChIKey | QSBOHNZMMQFWDH-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |