C16H16N2S — CID 144782380
ethane;9-methylbenzimidazolo[2,1-b][1,3]benzothiazole (PubChem CID 144782380) has the molecular formula C16H16N2S and a molecular weight of 268.39 g/mol. Its IUPAC name is ethane;9-methylbenzimidazolo[2,1-b][1,3]benzothiazole.
| Compound Name | ethane;9-methylbenzimidazolo[2,1-b][1,3]benzothiazole |
|---|---|
| PubChem CID | 144782380 |
| Molecular Formula | C16H16N2S |
| Molecular Weight | 268.39 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | ethane;9-methylbenzimidazolo[2,1-b][1,3]benzothiazole |
| SMILES | CC.Cc1ccc2nc3sc4ccccc4n3c2c1 |
| InChI | InChI=1S/C14H10N2S.C2H6/c1-9-6-7-10-12(8-9)16-11-4-2-3-5-13(11)17-14(16)15-10;1-2/h2-8H,1H3;1-2H3 |
| InChIKey | DFELLEHKZZEQKH-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.39 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |