C22H16N2O3S — CID 163394930
2-(3,5-dimethoxyphenyl)-[1,3]benzothiazolo[2,3-b]quinazolin-12-one (PubChem CID 163394930) has the molecular formula C22H16N2O3S and a molecular weight of 388.45 g/mol. Its IUPAC name is 2-(3,5-dimethoxyphenyl)-[1,3]benzothiazolo[2,3-b]quinazolin-12-one.
| Compound Name | 2-(3,5-dimethoxyphenyl)-[1,3]benzothiazolo[2,3-b]quinazolin-12-one |
|---|---|
| PubChem CID | 163394930 |
| Molecular Formula | C22H16N2O3S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 2-(3,5-dimethoxyphenyl)-[1,3]benzothiazolo[2,3-b]quinazolin-12-one |
| SMILES | COc1cc(OC)cc(-c2ccc3nc4sc5ccccc5n4c(=O)c3c2)c1 |
| InChI | InChI=1S/C22H16N2O3S/c1-26-15-9-14(10-16(12-15)27-2)13-7-8-18-17(11-13)21(25)24-19-5-3-4-6-20(19)28-22(24)23-18/h3-12H,1-2H3 |
| InChIKey | GVVRANODWGQTTB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |