C16H10N2O2S — CID 135418971
2-hydroxy-3-phenylpyrimido[2,1-b][1,3]benzothiazol-4-one (PubChem CID 135418971) has the molecular formula C16H10N2O2S and a molecular weight of 294.34 g/mol. Its IUPAC name is 2-hydroxy-3-phenylpyrimido[2,1-b][1,3]benzothiazol-4-one.
| Compound Name | 2-hydroxy-3-phenylpyrimido[2,1-b][1,3]benzothiazol-4-one |
|---|---|
| PubChem CID | 135418971 |
| Molecular Formula | C16H10N2O2S |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 2-hydroxy-3-phenylpyrimido[2,1-b][1,3]benzothiazol-4-one |
| SMILES | O=c1c(-c2ccccc2)c(O)nc2sc3ccccc3n12 |
| InChI | InChI=1S/C16H10N2O2S/c19-14-13(10-6-2-1-3-7-10)15(20)18-11-8-4-5-9-12(11)21-16(18)17-14/h1-9,19H |
| InChIKey | XOQCMROJRDZJEG-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |