C14H7ClN2OS — CID 15134484
2-chloro-[1,3]benzothiazolo[2,3-b]quinazolin-12-one (PubChem CID 15134484) has the molecular formula C14H7ClN2OS and a molecular weight of 286.74 g/mol. Its IUPAC name is 2-chloro-[1,3]benzothiazolo[2,3-b]quinazolin-12-one.
| Compound Name | 2-chloro-[1,3]benzothiazolo[2,3-b]quinazolin-12-one |
|---|---|
| PubChem CID | 15134484 |
| Molecular Formula | C14H7ClN2OS |
| Molecular Weight | 286.74 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | 2-chloro-[1,3]benzothiazolo[2,3-b]quinazolin-12-one |
| SMILES | O=c1c2cc(Cl)ccc2nc2sc3ccccc3n12 |
| InChI | InChI=1S/C14H7ClN2OS/c15-8-5-6-10-9(7-8)13(18)17-11-3-1-2-4-12(11)19-14(17)16-10/h1-7H |
| InChIKey | JPNHOCCRUQTMGT-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.74 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |