C9H11N3OS — CID 161197769
2-methyl-1,3-benzothiazole;urea (PubChem CID 161197769) has the molecular formula C9H11N3OS and a molecular weight of 209.27 g/mol. Its IUPAC name is 2-methyl-1,3-benzothiazole;urea.
| Compound Name | 2-methyl-1,3-benzothiazole;urea |
|---|---|
| PubChem CID | 161197769 |
| Molecular Formula | C9H11N3OS |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 2-methyl-1,3-benzothiazole;urea |
| SMILES | Cc1nc2ccccc2s1.NC(N)=O |
| InChI | InChI=1S/C8H7NS.CH4N2O/c1-6-9-7-4-2-3-5-8(7)10-6;2-1(3)4/h2-5H,1H3;(H4,2,3,4) |
| InChIKey | UUOOUOOCNRMEHJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |