C15H13N3S2 — CID 161214850
1,3-benzothiazol-2-amine;2-methyl-1,3-benzothiazole (PubChem CID 161214850) has the molecular formula C15H13N3S2 and a molecular weight of 299.42 g/mol. Its IUPAC name is 1,3-benzothiazol-2-amine;2-methyl-1,3-benzothiazole.
| Compound Name | 1,3-benzothiazol-2-amine;2-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 161214850 |
| Molecular Formula | C15H13N3S2 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 1,3-benzothiazol-2-amine;2-methyl-1,3-benzothiazole |
| SMILES | Cc1nc2ccccc2s1.Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C8H7NS.C7H6N2S/c1-6-9-7-4-2-3-5-8(7)10-6;8-7-9-5-3-1-2-4-6(5)10-7/h2-5H,1H3;1-4H,(H2,8,9) |
| InChIKey | UWSIWTAFBNBWLO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |