C14H9N3S2 — CID 135218835
4-(1,3-benzothiazol-2-yl)-1,3-benzothiazol-2-amine (PubChem CID 135218835) has the molecular formula C14H9N3S2 and a molecular weight of 283.38 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-1,3-benzothiazol-2-amine.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 135218835 |
| Molecular Formula | C14H9N3S2 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-1,3-benzothiazol-2-amine |
| SMILES | Nc1nc2c(-c3nc4ccccc4s3)cccc2s1 |
| InChI | InChI=1S/C14H9N3S2/c15-14-17-12-8(4-3-7-11(12)19-14)13-16-9-5-1-2-6-10(9)18-13/h1-7H,(H2,15,17) |
| InChIKey | ZGIZSYSUQLZSED-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |