C16H14N2S — CID 117420242
1-[2-(1,3-benzothiazol-2-yl)phenyl]cyclopropan-1-amine (PubChem CID 117420242) has the molecular formula C16H14N2S and a molecular weight of 266.37 g/mol. Its IUPAC name is 1-[2-(1,3-benzothiazol-2-yl)phenyl]cyclopropan-1-amine.
| Compound Name | 1-[2-(1,3-benzothiazol-2-yl)phenyl]cyclopropan-1-amine |
|---|---|
| PubChem CID | 117420242 |
| Molecular Formula | C16H14N2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 1-[2-(1,3-benzothiazol-2-yl)phenyl]cyclopropan-1-amine |
| SMILES | NC1(c2ccccc2-c2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C16H14N2S/c17-16(9-10-16)12-6-2-1-5-11(12)15-18-13-7-3-4-8-14(13)19-15/h1-8H,9-10,17H2 |
| InChIKey | XAZYCAJJAALEDL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |