About 4-(1,3-benzothiazol-2-yl)-1-methylcyclohepta-2,4-dien-1-amine
4-(1,3-benzothiazol-2-yl)-1-methylcyclohepta-2,4-dien-1-amine (PubChem CID 143177447) has the molecular formula C15H16N2S
and a molecular weight of 256.37 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-1-methylcyclohepta-2,4-dien-1-amine.
Molecular Properties
| Compound Name | 4-(1,3-benzothiazol-2-yl)-1-methylcyclohepta-2,4-dien-1-amine |
| PubChem CID | 143177447 |
| Molecular Formula | C15H16N2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-1-methylcyclohepta-2,4-dien-1-amine |
| SMILES | CC1(N)C=CC(c2nc3ccccc3s2)=CCC1 |
| InChI | InChI=1S/C15H16N2S/c1-15(16)9-4-5-11(8-10-15)14-17-12-6-2-3-7-13(12)18-14/h2-3,5-8,10H,4,9,16H2,1H3 |
| InChIKey | WTOKOZACCHNXSM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(1,3-benzothiazol-2-yl)-1-methylcyclohepta-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-benzothiazol-2-yl)-1-methylcyclohepta-2,4-dien-1-amine?
The IUPAC name of 4-(1,3-benzothiazol-2-yl)-1-methylcyclohepta-2,4-dien-1-amine (CID 143177447) is 4-(1,3-benzothiazol-2-yl)-1-methylcyclohepta-2,4-dien-1-amine.
What is the SMILES notation for 4-(1,3-benzothiazol-2-yl)-1-methylcyclohepta-2,4-dien-1-amine?
The canonical SMILES for 4-(1,3-benzothiazol-2-yl)-1-methylcyclohepta-2,4-dien-1-amine is CC1(N)C=CC(c2nc3ccccc3s2)=CCC1.
What is the InChIKey of 4-(1,3-benzothiazol-2-yl)-1-methylcyclohepta-2,4-dien-1-amine?
The InChIKey is WTOKOZACCHNXSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2S/c1-15(16)9-4-5-11(8-10-15)14-17-12-6-2-3-7-13(12)18-14/h2-3,5-8,10H,4,9,16H2,1H3.
What are the key properties of 4-(1,3-benzothiazol-2-yl)-1-methylcyclohepta-2,4-dien-1-amine?
4-(1,3-benzothiazol-2-yl)-1-methylcyclohepta-2,4-dien-1-amine has a molecular weight of 256.37 g/mol, XLogP of 3.75, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzothiazol-2-yl)-1-methylcyclohepta-2,4-dien-1-amine is sourced from PubChem (CID 143177447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).