C12H9NOS — CID 3264944
2-(2-methylfuran-3-yl)-1,3-benzothiazole (PubChem CID 3264944) has the molecular formula C12H9NOS and a molecular weight of 215.28 g/mol. Its IUPAC name is 2-(2-methylfuran-3-yl)-1,3-benzothiazole.
| Compound Name | 2-(2-methylfuran-3-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 3264944 |
| Molecular Formula | C12H9NOS |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | 2-(2-methylfuran-3-yl)-1,3-benzothiazole |
| SMILES | Cc1occc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C12H9NOS/c1-8-9(6-7-14-8)12-13-10-4-2-3-5-11(10)15-12/h2-7H,1H3 |
| InChIKey | UXSVKYXZIXGJIC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |