C15H13NS — CID 14365937
2-(2,5-dimethylphenyl)-1,3-benzothiazole (PubChem CID 14365937) has the molecular formula C15H13NS and a molecular weight of 239.34 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-1,3-benzothiazole.
| Compound Name | 2-(2,5-dimethylphenyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 14365937 |
| Molecular Formula | C15H13NS |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 2-(2,5-dimethylphenyl)-1,3-benzothiazole |
| SMILES | Cc1ccc(C)c(-c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C15H13NS/c1-10-7-8-11(2)12(9-10)15-16-13-5-3-4-6-14(13)17-15/h3-9H,1-2H3 |
| InChIKey | RUKDAISPPZINMU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |