C14H11NS2 — CID 175383915
2-(1,3-benzothiazol-2-yl)-5-methylbenzenethiol (PubChem CID 175383915) has the molecular formula C14H11NS2 and a molecular weight of 257.38 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-5-methylbenzenethiol.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-5-methylbenzenethiol |
|---|---|
| PubChem CID | 175383915 |
| Molecular Formula | C14H11NS2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-5-methylbenzenethiol |
| SMILES | Cc1ccc(-c2nc3ccccc3s2)c(S)c1 |
| InChI | InChI=1S/C14H11NS2/c1-9-6-7-10(12(16)8-9)14-15-11-4-2-3-5-13(11)17-14/h2-8,16H,1H3 |
| InChIKey | QCUJOSPZKSZXBZ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|