C15H9NOS — CID 123795055
2-(1-benzofuran-6-yl)-1,3-benzothiazole (PubChem CID 123795055) has the molecular formula C15H9NOS and a molecular weight of 251.31 g/mol. Its IUPAC name is 2-(1-benzofuran-6-yl)-1,3-benzothiazole.
| Compound Name | 2-(1-benzofuran-6-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 123795055 |
| Molecular Formula | C15H9NOS |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | 2-(1-benzofuran-6-yl)-1,3-benzothiazole |
| SMILES | c1ccc2sc(-c3ccc4ccoc4c3)nc2c1 |
| InChI | InChI=1S/C15H9NOS/c1-2-4-14-12(3-1)16-15(18-14)11-6-5-10-7-8-17-13(10)9-11/h1-9H |
| InChIKey | OWYYAAYJFQATMM-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |