C13H6Cl3NS — CID 50849600
2-(3,4,5-trichlorophenyl)-1,3-benzothiazole (PubChem CID 50849600) has the molecular formula C13H6Cl3NS and a molecular weight of 314.62 g/mol. Its IUPAC name is 2-(3,4,5-trichlorophenyl)-1,3-benzothiazole.
| Compound Name | 2-(3,4,5-trichlorophenyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 50849600 |
| Molecular Formula | C13H6Cl3NS |
| Molecular Weight | 314.62 g/mol |
| Exact Mass | 312.93 |
| IUPAC Name | 2-(3,4,5-trichlorophenyl)-1,3-benzothiazole |
| SMILES | Clc1cc(-c2nc3ccccc3s2)cc(Cl)c1Cl |
| InChI | InChI=1S/C13H6Cl3NS/c14-8-5-7(6-9(15)12(8)16)13-17-10-3-1-2-4-11(10)18-13/h1-6H |
| InChIKey | HVNVHIDGWFTHFP-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.62 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|